C11H10ClN5O2 — CID 60739971
3-chloro-N-[2-oxo-2-(1H-1,2,4-triazol-5-ylamino)ethyl]benzamide (PubChem CID 60739971) has the molecular formula C11H10ClN5O2 and a molecular weight of 279.69 g/mol. Its IUPAC name is 3-chloro-N-[2-oxo-2-(1H-1,2,4-triazol-5-ylamino)ethyl]benzamide.
| Compound Name | 3-chloro-N-[2-oxo-2-(1H-1,2,4-triazol-5-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 60739971 |
| Molecular Formula | C11H10ClN5O2 |
| Molecular Weight | 279.69 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 3-chloro-N-[2-oxo-2-(1H-1,2,4-triazol-5-ylamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Cl)c1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C11H10ClN5O2/c12-8-3-1-2-7(4-8)10(19)13-5-9(18)16-11-14-6-15-17-11/h1-4,6H,5H2,(H,13,19)(H2,14,15,16,17,18) |
| InChIKey | HZMPIRAHEMLDDN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.69 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |