C19H17BrClN5OS — CID 6076572
N-[(Z)-1-(4-bromophenyl)ethylideneamino]-2-[[5-(3-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6076572) has the molecular formula C19H17BrClN5OS and a molecular weight of 478.80 g/mol. Its IUPAC name is N-[(Z)-1-(4-bromophenyl)ethylideneamino]-2-[[5-(3-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-1-(4-bromophenyl)ethylideneamino]-2-[[5-(3-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6076572 |
| Molecular Formula | C19H17BrClN5OS |
| Molecular Weight | 478.80 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | N-[(Z)-1-(4-bromophenyl)ethylideneamino]-2-[[5-(3-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C/C(=N/NC(=O)CSc1nnc(-c2cccc(Cl)c2)n1C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrClN5OS/c1-12(13-6-8-15(20)9-7-13)22-23-17(27)11-28-19-25-24-18(26(19)2)14-4-3-5-16(21)10-14/h3-10H,11H2,1-2H3,(H,23,27)/b22-12- |
| InChIKey | JAONIGTXUKSMSO-UUYOSTAYSA-N |
| XLogP | 4.53 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.80 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|