C20H20ClN5OS — CID 6517417
2-[[5-(3-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-phenylpropylideneamino]acetamide (PubChem CID 6517417) has the molecular formula C20H20ClN5OS and a molecular weight of 413.93 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-phenylpropylideneamino]acetamide.
| Compound Name | 2-[[5-(3-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-phenylpropylideneamino]acetamide |
|---|---|
| PubChem CID | 6517417 |
| Molecular Formula | C20H20ClN5OS |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-1-phenylpropylideneamino]acetamide |
| SMILES | CC/C(=N/NC(=O)CSc1nnc(-c2cccc(Cl)c2)n1C)c1ccccc1 |
| InChI | InChI=1S/C20H20ClN5OS/c1-3-17(14-8-5-4-6-9-14)22-23-18(27)13-28-20-25-24-19(26(20)2)15-10-7-11-16(21)12-15/h4-12H,3,13H2,1-2H3,(H,23,27)/b22-17- |
| InChIKey | SGEQEYDATFLCSX-XLNRJJMWSA-N |
| XLogP | 4.16 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|