About ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate
ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate (PubChem CID 60778537) has the molecular formula C11H18F3NO3
and a molecular weight of 269.26 g/mol. Its IUPAC name is ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate.
Analyze ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate?
The IUPAC name of ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate (CID 60778537) is ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate.
What is the SMILES notation for ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate?
The canonical SMILES for ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate is CCCN(CC(F)(F)F)C(=O)CCC(=O)OCC.
What is the InChIKey of ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate?
The InChIKey is MLUYPNXGAUEKPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO3/c1-3-7-15(8-11(12,13)14)9(16)5-6-10(17)18-4-2/h3-8H2,1-2H3.
What are the key properties of ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate?
ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate has a molecular weight of 269.26 g/mol, XLogP of 2.13, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxo-4-[propyl(2,2,2-trifluoroethyl)amino]butanoate is sourced from PubChem (CID 60778537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).