methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate

C9H13F2NO3 — CID 116991736

IUPACmethyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate
SMILESCOC(=O)CCC(=O)N1CCC(F)(F)C1
InChIInChI=1S/C9H13F2NO3/c1-15-8(14)3-2-7(13)12-5-4-9(10,11)6-12/h2-6H2,1H3
InChIKeyYENVJXHOUUZCPG-UHFFFAOYSA-N
MW221.20 g/mol
LogP0.81
Rot. Bonds3

About methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate

methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate (PubChem CID 116991736) has the molecular formula C9H13F2NO3 and a molecular weight of 221.20 g/mol. Its IUPAC name is methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate.

Molecular Properties

Compound Namemethyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate
PubChem CID116991736
Molecular FormulaC9H13F2NO3
Molecular Weight221.20 g/mol
Exact Mass221.09
IUPAC Namemethyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate
SMILESCOC(=O)CCC(=O)N1CCC(F)(F)C1
InChIInChI=1S/C9H13F2NO3/c1-15-8(14)3-2-7(13)12-5-4-9(10,11)6-12/h2-6H2,1H3
InChIKeyYENVJXHOUUZCPG-UHFFFAOYSA-N
XLogP0.81
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.20
LogP ≤ 50.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate?
The IUPAC name of methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate (CID 116991736) is methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate.
What is the SMILES notation for methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate?
The canonical SMILES for methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate is COC(=O)CCC(=O)N1CCC(F)(F)C1.
What is the InChIKey of methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate?
The InChIKey is YENVJXHOUUZCPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO3/c1-15-8(14)3-2-7(13)12-5-4-9(10,11)6-12/h2-6H2,1H3.
What are the key properties of methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate?
methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate has a molecular weight of 221.20 g/mol, XLogP of 0.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3,3-difluoropyrrolidin-1-yl)-4-oxobutanoate is sourced from PubChem (CID 116991736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).