C10H16BrN3OS — CID 60783690
7-amino-N-(5-bromo-1,3-thiazol-2-yl)heptanamide (PubChem CID 60783690) has the molecular formula C10H16BrN3OS and a molecular weight of 306.23 g/mol. Its IUPAC name is 7-amino-N-(5-bromo-1,3-thiazol-2-yl)heptanamide.
| Compound Name | 7-amino-N-(5-bromo-1,3-thiazol-2-yl)heptanamide |
|---|---|
| PubChem CID | 60783690 |
| Molecular Formula | C10H16BrN3OS |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 7-amino-N-(5-bromo-1,3-thiazol-2-yl)heptanamide |
| SMILES | NCCCCCCC(=O)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C10H16BrN3OS/c11-8-7-13-10(16-8)14-9(15)5-3-1-2-4-6-12/h7H,1-6,12H2,(H,13,14,15) |
| InChIKey | ZWJQBITTZBVDPC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|