C14H18F3NO2 — CID 60786030
ethyl 2-(ethylamino)-2-[2-(trifluoromethyl)phenyl]propanoate (PubChem CID 60786030) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is ethyl 2-(ethylamino)-2-[2-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl 2-(ethylamino)-2-[2-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 60786030 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | ethyl 2-(ethylamino)-2-[2-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCNC(C)(C(=O)OCC)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO2/c1-4-18-13(3,12(19)20-5-2)10-8-6-7-9-11(10)14(15,16)17/h6-9,18H,4-5H2,1-3H3 |
| InChIKey | VLWZFWXZLGEKTD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |