C13H9N3O5 — CID 60804555
N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-5-nitrofuran-2-carboxamide (PubChem CID 60804555) has the molecular formula C13H9N3O5 and a molecular weight of 287.23 g/mol. Its IUPAC name is N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 60804555 |
| Molecular Formula | C13H9N3O5 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-5-nitrofuran-2-carboxamide |
| SMILES | O=C(Nc1cccc(C#CCO)n1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C13H9N3O5/c17-8-2-4-9-3-1-5-11(14-9)15-13(18)10-6-7-12(21-10)16(19)20/h1,3,5-7,17H,8H2,(H,14,15,18) |
| InChIKey | MSIUYDZXUNTEJV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|