C31H25F2NO2 — CID 6080529
(E)-3-[2-(difluoromethoxy)phenyl]-1-(2-methyl-2,3-dihydroindol-1-yl)-2-(4-phenylphenyl)prop-2-en-1-one (PubChem CID 6080529) has the molecular formula C31H25F2NO2 and a molecular weight of 481.54 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-1-(2-methyl-2,3-dihydroindol-1-yl)-2-(4-phenylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-1-(2-methyl-2,3-dihydroindol-1-yl)-2-(4-phenylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6080529 |
| Molecular Formula | C31H25F2NO2 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-1-(2-methyl-2,3-dihydroindol-1-yl)-2-(4-phenylphenyl)prop-2-en-1-one |
| SMILES | CC1Cc2ccccc2N1C(=O)/C(=C/c1ccccc1OC(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H25F2NO2/c1-21-19-25-11-5-7-13-28(25)34(21)30(35)27(20-26-12-6-8-14-29(26)36-31(32)33)24-17-15-23(16-18-24)22-9-3-2-4-10-22/h2-18,20-21,31H,19H2,1H3/b27-20+ |
| InChIKey | BXUHGAMBTTXAAH-NHFJDJAPSA-N |
| XLogP | 7.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|