C13H19N5O2S — CID 60808797
3-amino-1-propyl-N-(1-pyridin-2-ylethyl)pyrazole-4-sulfonamide (PubChem CID 60808797) has the molecular formula C13H19N5O2S and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-amino-1-propyl-N-(1-pyridin-2-ylethyl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-propyl-N-(1-pyridin-2-ylethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60808797 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-amino-1-propyl-N-(1-pyridin-2-ylethyl)pyrazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)NC(C)c2ccccn2)c(N)n1 |
| InChI | InChI=1S/C13H19N5O2S/c1-3-8-18-9-12(13(14)16-18)21(19,20)17-10(2)11-6-4-5-7-15-11/h4-7,9-10,17H,3,8H2,1-2H3,(H2,14,16) |
| InChIKey | PWRHOMRYFAXPHM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |