C10H14N6O2S — CID 60809886
3-amino-N,N-bis(cyanomethyl)-1-propylpyrazole-4-sulfonamide (PubChem CID 60809886) has the molecular formula C10H14N6O2S and a molecular weight of 282.33 g/mol. Its IUPAC name is 3-amino-N,N-bis(cyanomethyl)-1-propylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N,N-bis(cyanomethyl)-1-propylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60809886 |
| Molecular Formula | C10H14N6O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-amino-N,N-bis(cyanomethyl)-1-propylpyrazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)N(CC#N)CC#N)c(N)n1 |
| InChI | InChI=1S/C10H14N6O2S/c1-2-5-15-8-9(10(13)14-15)19(17,18)16(6-3-11)7-4-12/h8H,2,5-7H2,1H3,(H2,13,14) |
| InChIKey | DPJNPXHENXZFCB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|