C10H7F3N4OS — CID 60810768
N-(1H-1,2,4-triazol-5-yl)-2-(trifluoromethylsulfanyl)benzamide (PubChem CID 60810768) has the molecular formula C10H7F3N4OS and a molecular weight of 288.25 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-yl)-2-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-(1H-1,2,4-triazol-5-yl)-2-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 60810768 |
| Molecular Formula | C10H7F3N4OS |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-yl)-2-(trifluoromethylsulfanyl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C10H7F3N4OS/c11-10(12,13)19-7-4-2-1-3-6(7)8(18)16-9-14-5-15-17-9/h1-5H,(H2,14,15,16,17,18) |
| InChIKey | USEYXASKLJFDCY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |