C14H16ClNO3S — CID 60827113
2-[[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-cyclopentylamino]acetic acid (PubChem CID 60827113) has the molecular formula C14H16ClNO3S and a molecular weight of 313.81 g/mol. Its IUPAC name is 2-[[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-cyclopentylamino]acetic acid.
| Compound Name | 2-[[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-cyclopentylamino]acetic acid |
|---|---|
| PubChem CID | 60827113 |
| Molecular Formula | C14H16ClNO3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-[[(E)-3-(5-chlorothiophen-2-yl)prop-2-enoyl]-cyclopentylamino]acetic acid |
| SMILES | O=C(O)CN(C(=O)/C=C/c1ccc(Cl)s1)C1CCCC1 |
| InChI | InChI=1S/C14H16ClNO3S/c15-12-7-5-11(20-12)6-8-13(17)16(9-14(18)19)10-3-1-2-4-10/h5-8,10H,1-4,9H2,(H,18,19)/b8-6+ |
| InChIKey | JJGSNDCBYSSMOD-SOFGYWHQSA-N |
| XLogP | 3.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|