C12H12ClNO3S — CID 77048570
2-[1-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]azetidin-3-yl]acetic acid (PubChem CID 77048570) has the molecular formula C12H12ClNO3S and a molecular weight of 285.75 g/mol. Its IUPAC name is 2-[1-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]azetidin-3-yl]acetic acid.
| Compound Name | 2-[1-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 77048570 |
| Molecular Formula | C12H12ClNO3S |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-[1-[3-(5-chlorothiophen-2-yl)prop-2-enoyl]azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)C=Cc2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C12H12ClNO3S/c13-10-3-1-9(18-10)2-4-11(15)14-6-8(7-14)5-12(16)17/h1-4,8H,5-7H2,(H,16,17) |
| InChIKey | ICMYYPCFBZYGDQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|