C15H17NO5 — CID 60832514
4-[N-(2,3-dihydro-1,4-dioxine-5-carbonyl)anilino]butanoic acid (PubChem CID 60832514) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 4-[N-(2,3-dihydro-1,4-dioxine-5-carbonyl)anilino]butanoic acid.
| Compound Name | 4-[N-(2,3-dihydro-1,4-dioxine-5-carbonyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 60832514 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-[N-(2,3-dihydro-1,4-dioxine-5-carbonyl)anilino]butanoic acid |
| SMILES | O=C(O)CCCN(C(=O)C1=COCCO1)c1ccccc1 |
| InChI | InChI=1S/C15H17NO5/c17-14(18)7-4-8-16(12-5-2-1-3-6-12)15(19)13-11-20-9-10-21-13/h1-3,5-6,11H,4,7-10H2,(H,17,18) |
| InChIKey | DZAGNSHFWFUHBD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |