C16H13FN2O2 — CID 60835787
3-(2-fluorophenyl)-1-phenyl-1,3-diazinane-2,4-dione (PubChem CID 60835787) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-phenyl-1,3-diazinane-2,4-dione.
| Compound Name | 3-(2-fluorophenyl)-1-phenyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 60835787 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-(2-fluorophenyl)-1-phenyl-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2ccccc2)C(=O)N1c1ccccc1F |
| InChI | InChI=1S/C16H13FN2O2/c17-13-8-4-5-9-14(13)19-15(20)10-11-18(16(19)21)12-6-2-1-3-7-12/h1-9H,10-11H2 |
| InChIKey | UZMFVRWONBJMSP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |