C14H15Cl2N3 — CID 60853729
1-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]cyclopentan-1-amine (PubChem CID 60853729) has the molecular formula C14H15Cl2N3 and a molecular weight of 296.20 g/mol. Its IUPAC name is 1-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]cyclopentan-1-amine.
| Compound Name | 1-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 60853729 |
| Molecular Formula | C14H15Cl2N3 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 1-[5-(2,4-dichlorophenyl)-1H-imidazol-2-yl]cyclopentan-1-amine |
| SMILES | NC1(c2ncc(-c3ccc(Cl)cc3Cl)[nH]2)CCCC1 |
| InChI | InChI=1S/C14H15Cl2N3/c15-9-3-4-10(11(16)7-9)12-8-18-13(19-12)14(17)5-1-2-6-14/h3-4,7-8H,1-2,5-6,17H2,(H,18,19) |
| InChIKey | LLSCCFNMRCYRNL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |