C8H14N4S — CID 60855283
4-[(1-methylpyrrolidin-3-yl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 60855283) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is 4-[(1-methylpyrrolidin-3-yl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(1-methylpyrrolidin-3-yl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 60855283 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-[(1-methylpyrrolidin-3-yl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CN1CCC(Cn2cn[nH]c2=S)C1 |
| InChI | InChI=1S/C8H14N4S/c1-11-3-2-7(4-11)5-12-6-9-10-8(12)13/h6-7H,2-5H2,1H3,(H,10,13) |
| InChIKey | NRSWPFSRWXTNGD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|