C10H18N2O6S2 — CID 60858082
1-[(1,1-dioxothiolan-3-yl)sulfamoyl]piperidine-3-carboxylic acid (PubChem CID 60858082) has the molecular formula C10H18N2O6S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)sulfamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)sulfamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 60858082 |
| Molecular Formula | C10H18N2O6S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)sulfamoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(S(=O)(=O)NC2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C10H18N2O6S2/c13-10(14)8-2-1-4-12(6-8)20(17,18)11-9-3-5-19(15,16)7-9/h8-9,11H,1-7H2,(H,13,14) |
| InChIKey | YWWZOYRSGGEAIJ-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |