C12H13ClN2O3S — CID 60859954
3-[[(5-chlorofuran-2-yl)methylamino]methyl]benzenesulfonamide (PubChem CID 60859954) has the molecular formula C12H13ClN2O3S and a molecular weight of 300.77 g/mol. Its IUPAC name is 3-[[(5-chlorofuran-2-yl)methylamino]methyl]benzenesulfonamide.
| Compound Name | 3-[[(5-chlorofuran-2-yl)methylamino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60859954 |
| Molecular Formula | C12H13ClN2O3S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 3-[[(5-chlorofuran-2-yl)methylamino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(CNCc2ccc(Cl)o2)c1 |
| InChI | InChI=1S/C12H13ClN2O3S/c13-12-5-4-10(18-12)8-15-7-9-2-1-3-11(6-9)19(14,16)17/h1-6,15H,7-8H2,(H2,14,16,17) |
| InChIKey | LSAMZPFODKVDIN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |