C11H18N4O3 — CID 60864470
4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butanamide (PubChem CID 60864470) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butanamide.
| Compound Name | 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 60864470 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 4-[(4,6-dimethoxypyrimidin-5-yl)methylamino]butanamide |
| SMILES | COc1ncnc(OC)c1CNCCCC(N)=O |
| InChI | InChI=1S/C11H18N4O3/c1-17-10-8(11(18-2)15-7-14-10)6-13-5-3-4-9(12)16/h7,13H,3-6H2,1-2H3,(H2,12,16) |
| InChIKey | RQACKGFKOKCYON-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|