C7H12N2O2 — CID 60869048
1-(1,2-oxazol-4-ylmethylamino)propan-2-ol (PubChem CID 60869048) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is 1-(1,2-oxazol-4-ylmethylamino)propan-2-ol.
| Compound Name | 1-(1,2-oxazol-4-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 60869048 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-(1,2-oxazol-4-ylmethylamino)propan-2-ol |
| SMILES | CC(O)CNCc1cnoc1 |
| InChI | InChI=1S/C7H12N2O2/c1-6(10)2-8-3-7-4-9-11-5-7/h4-6,8,10H,2-3H2,1H3 |
| InChIKey | JASUVUBZBNGPGE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |