C8H14ClNO2S — CID 60871661
N-(2-chloroprop-2-enyl)-1,1-dioxothian-4-amine (PubChem CID 60871661) has the molecular formula C8H14ClNO2S and a molecular weight of 223.72 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(2-chloroprop-2-enyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 60871661 |
| Molecular Formula | C8H14ClNO2S |
| Molecular Weight | 223.72 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-1,1-dioxothian-4-amine |
| SMILES | C=C(Cl)CNC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H14ClNO2S/c1-7(9)6-10-8-2-4-13(11,12)5-3-8/h8,10H,1-6H2 |
| InChIKey | KESVMRZMPOPLTE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.72 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |