C10H21BrN2 — CID 60872428
N-(2-bromoprop-2-enyl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 60872428) has the molecular formula C10H21BrN2 and a molecular weight of 249.20 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-(2-bromoprop-2-enyl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 60872428 |
| Molecular Formula | C10H21BrN2 |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | C=C(Br)CNCCCN(CC)CC |
| InChI | InChI=1S/C10H21BrN2/c1-4-13(5-2)8-6-7-12-9-10(3)11/h12H,3-9H2,1-2H3 |
| InChIKey | NUZRBWMUHXQECE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|