C9H19BrN2 — CID 60871843
N-(2-bromoprop-2-enyl)-N',N'-diethylethane-1,2-diamine (PubChem CID 60871843) has the molecular formula C9H19BrN2 and a molecular weight of 235.17 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(2-bromoprop-2-enyl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 60871843 |
| Molecular Formula | C9H19BrN2 |
| Molecular Weight | 235.17 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-N',N'-diethylethane-1,2-diamine |
| SMILES | C=C(Br)CNCCN(CC)CC |
| InChI | InChI=1S/C9H19BrN2/c1-4-12(5-2)7-6-11-8-9(3)10/h11H,3-8H2,1-2H3 |
| InChIKey | KHLPBGIKSZAERC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|