C12H14N6O3 — CID 60876095
2-[(4-aminophenyl)methyl-(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide (PubChem CID 60876095) has the molecular formula C12H14N6O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methyl-(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide.
| Compound Name | 2-[(4-aminophenyl)methyl-(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 60876095 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[(4-aminophenyl)methyl-(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide |
| SMILES | NC(=O)CN(Cc1ccc(N)cc1)c1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H14N6O3/c13-8-3-1-7(2-4-8)5-18(6-9(14)19)10-11(20)15-12(21)17-16-10/h1-4H,5-6,13H2,(H2,14,19)(H2,15,17,20,21) |
| InChIKey | IISVFOXYPIAWRI-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|