C13H12N6O2 — CID 60876176
1-methyl-N-[(4-nitrophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 60876176) has the molecular formula C13H12N6O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is 1-methyl-N-[(4-nitrophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-methyl-N-[(4-nitrophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 60876176 |
| Molecular Formula | C13H12N6O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-methyl-N-[(4-nitrophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cn1ncc2c(NCc3ccc([N+](=O)[O-])cc3)ncnc21 |
| InChI | InChI=1S/C13H12N6O2/c1-18-13-11(7-17-18)12(15-8-16-13)14-6-9-2-4-10(5-3-9)19(20)21/h2-5,7-8H,6H2,1H3,(H,14,15,16) |
| InChIKey | AMMZPIGFKMYTCZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|