C20H19N7O2 — CID 67630616
1-N-[(4-nitrophenyl)methyl]-4-N-[(1S)-1-phenylethyl]pyrazolo[3,4-d]pyrimidine-1,4-diamine (PubChem CID 67630616) has the molecular formula C20H19N7O2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-N-[(4-nitrophenyl)methyl]-4-N-[(1S)-1-phenylethyl]pyrazolo[3,4-d]pyrimidine-1,4-diamine.
| Compound Name | 1-N-[(4-nitrophenyl)methyl]-4-N-[(1S)-1-phenylethyl]pyrazolo[3,4-d]pyrimidine-1,4-diamine |
|---|---|
| PubChem CID | 67630616 |
| Molecular Formula | C20H19N7O2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-N-[(4-nitrophenyl)methyl]-4-N-[(1S)-1-phenylethyl]pyrazolo[3,4-d]pyrimidine-1,4-diamine |
| SMILES | C[C@H](Nc1ncnc2c1cnn2NCc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C20H19N7O2/c1-14(16-5-3-2-4-6-16)25-19-18-12-24-26(20(18)22-13-21-19)23-11-15-7-9-17(10-8-15)27(28)29/h2-10,12-14,23H,11H2,1H3,(H,21,22,25)/t14-/m0/s1 |
| InChIKey | ITXCPTPIFFAUFJ-AWEZNQCLSA-N |
| XLogP | 3.65 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|