C13H14ClNOS — CID 60882008
1-[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]-N-methylmethanamine (PubChem CID 60882008) has the molecular formula C13H14ClNOS and a molecular weight of 267.78 g/mol. Its IUPAC name is 1-[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 60882008 |
| Molecular Formula | C13H14ClNOS |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 1-[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(Cl)ccc1OCc1cccs1 |
| InChI | InChI=1S/C13H14ClNOS/c1-15-8-10-7-11(14)4-5-13(10)16-9-12-3-2-6-17-12/h2-7,15H,8-9H2,1H3 |
| InChIKey | BNXVYYBWFFVXBP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |