C16H21Cl2NOS — CID 2941503
N-[[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methylpropan-2-amine;hydrochloride (PubChem CID 2941503) has the molecular formula C16H21Cl2NOS and a molecular weight of 346.32 g/mol. Its IUPAC name is N-[[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methylpropan-2-amine;hydrochloride.
| Compound Name | N-[[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 2941503 |
| Molecular Formula | C16H21Cl2NOS |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-[[5-chloro-2-(thiophen-2-ylmethoxy)phenyl]methyl]-2-methylpropan-2-amine;hydrochloride |
| SMILES | CC(C)(C)NCc1cc(Cl)ccc1OCc1cccs1.Cl |
| InChI | InChI=1S/C16H20ClNOS.ClH/c1-16(2,3)18-10-12-9-13(17)6-7-15(12)19-11-14-5-4-8-20-14;/h4-9,18H,10-11H2,1-3H3;1H |
| InChIKey | WQVVQHDEQGLPLG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |