C19H19Cl2NOS — CID 17290374
N-[(5-chloro-2-phenylmethoxyphenyl)methyl]-1-thiophen-2-ylmethanamine;hydrochloride (PubChem CID 17290374) has the molecular formula C19H19Cl2NOS and a molecular weight of 380.34 g/mol. Its IUPAC name is N-[(5-chloro-2-phenylmethoxyphenyl)methyl]-1-thiophen-2-ylmethanamine;hydrochloride.
| Compound Name | N-[(5-chloro-2-phenylmethoxyphenyl)methyl]-1-thiophen-2-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 17290374 |
| Molecular Formula | C19H19Cl2NOS |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[(5-chloro-2-phenylmethoxyphenyl)methyl]-1-thiophen-2-ylmethanamine;hydrochloride |
| SMILES | Cl.Clc1ccc(OCc2ccccc2)c(CNCc2cccs2)c1 |
| InChI | InChI=1S/C19H18ClNOS.ClH/c20-17-8-9-19(22-14-15-5-2-1-3-6-15)16(11-17)12-21-13-18-7-4-10-23-18;/h1-11,21H,12-14H2;1H |
| InChIKey | FJGFYMYPFCEMLI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |