C19H21NO — CID 60885260
2-(9H-fluoren-2-ylamino)cyclohexan-1-ol (PubChem CID 60885260) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-(9H-fluoren-2-ylamino)cyclohexan-1-ol.
| Compound Name | 2-(9H-fluoren-2-ylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 60885260 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-(9H-fluoren-2-ylamino)cyclohexan-1-ol |
| SMILES | OC1CCCCC1Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C19H21NO/c21-19-8-4-3-7-18(19)20-15-9-10-17-14(12-15)11-13-5-1-2-6-16(13)17/h1-2,5-6,9-10,12,18-21H,3-4,7-8,11H2 |
| InChIKey | WJZJRXOLWFMZMZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |