C18H17NO2 — CID 103232769
2-(9H-fluoren-2-ylamino)cyclobutane-1-carboxylic acid (PubChem CID 103232769) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(9H-fluoren-2-ylamino)cyclobutane-1-carboxylic acid.
| Compound Name | 2-(9H-fluoren-2-ylamino)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 103232769 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-(9H-fluoren-2-ylamino)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC1Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C18H17NO2/c20-18(21)16-7-8-17(16)19-13-5-6-15-12(10-13)9-11-3-1-2-4-14(11)15/h1-6,10,16-17,19H,7-9H2,(H,20,21) |
| InChIKey | BJDFWSCXKSVTKZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |