About N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine
N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine (PubChem CID 81469099) has the molecular formula C19H22N2
and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine |
| PubChem CID | 81469099 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine |
| SMILES | CC1CC(Nc2ccc3c(c2)Cc2ccccc2-3)CN1C |
| InChI | InChI=1S/C19H22N2/c1-13-9-17(12-21(13)2)20-16-7-8-19-15(11-16)10-14-5-3-4-6-18(14)19/h3-8,11,13,17,20H,9-10,12H2,1-2H3 |
| InChIKey | XQGLAFZNCVSNTD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine?
The IUPAC name of N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine (CID 81469099) is N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine.
What is the SMILES notation for N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine?
The canonical SMILES for N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine is CC1CC(Nc2ccc3c(c2)Cc2ccccc2-3)CN1C.
What is the InChIKey of N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine?
The InChIKey is XQGLAFZNCVSNTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2/c1-13-9-17(12-21(13)2)20-16-7-8-19-15(11-16)10-14-5-3-4-6-18(14)19/h3-8,11,13,17,20H,9-10,12H2,1-2H3.
What are the key properties of N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine?
N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine has a molecular weight of 278.40 g/mol, XLogP of 3.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(9H-fluoren-2-yl)-1,5-dimethylpyrrolidin-3-amine is sourced from PubChem (CID 81469099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).