C13H20N4O — CID 81466059
[3-[(1,5-dimethylpyrrolidin-3-yl)amino]phenyl]urea (PubChem CID 81466059) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is [3-[(1,5-dimethylpyrrolidin-3-yl)amino]phenyl]urea.
| Compound Name | [3-[(1,5-dimethylpyrrolidin-3-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 81466059 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [3-[(1,5-dimethylpyrrolidin-3-yl)amino]phenyl]urea |
| SMILES | CC1CC(Nc2cccc(NC(N)=O)c2)CN1C |
| InChI | InChI=1S/C13H20N4O/c1-9-6-12(8-17(9)2)15-10-4-3-5-11(7-10)16-13(14)18/h3-5,7,9,12,15H,6,8H2,1-2H3,(H3,14,16,18) |
| InChIKey | RYABUCCRBZPAAX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |