C12H17ClN2 — CID 81466507
N-(3-chlorophenyl)-1,5-dimethylpyrrolidin-3-amine (PubChem CID 81466507) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1,5-dimethylpyrrolidin-3-amine.
| Compound Name | N-(3-chlorophenyl)-1,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 81466507 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-(3-chlorophenyl)-1,5-dimethylpyrrolidin-3-amine |
| SMILES | CC1CC(Nc2cccc(Cl)c2)CN1C |
| InChI | InChI=1S/C12H17ClN2/c1-9-6-12(8-15(9)2)14-11-5-3-4-10(13)7-11/h3-5,7,9,12,14H,6,8H2,1-2H3 |
| InChIKey | KTRGJTXKVPYZMO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |