4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid

C13H18N2O2 — CID 81466326

IUPAC4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid
SMILESCC1CC(Nc2ccc(C(=O)O)cc2)CN1C
InChIInChI=1S/C13H18N2O2/c1-9-7-12(8-15(9)2)14-11-5-3-10(4-6-11)13(16)17/h3-6,9,12,14H,7-8H2,1-2H3,(H,16,17)
InChIKeyNPDXICJAJSOEOV-UHFFFAOYSA-N
MW234.30 g/mol
LogP1.89
Rot. Bonds3

About 4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid

4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid (PubChem CID 81466326) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid.

Molecular Properties

Compound Name4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid
PubChem CID81466326
Molecular FormulaC13H18N2O2
Molecular Weight234.30 g/mol
Exact Mass234.14
IUPAC Name4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid
SMILESCC1CC(Nc2ccc(C(=O)O)cc2)CN1C
InChIInChI=1S/C13H18N2O2/c1-9-7-12(8-15(9)2)14-11-5-3-10(4-6-11)13(16)17/h3-6,9,12,14H,7-8H2,1-2H3,(H,16,17)
InChIKeyNPDXICJAJSOEOV-UHFFFAOYSA-N
XLogP1.89
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.30
LogP ≤ 51.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid?
The IUPAC name of 4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid (CID 81466326) is 4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid.
What is the SMILES notation for 4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid?
The canonical SMILES for 4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid is CC1CC(Nc2ccc(C(=O)O)cc2)CN1C.
What is the InChIKey of 4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid?
The InChIKey is NPDXICJAJSOEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-9-7-12(8-15(9)2)14-11-5-3-10(4-6-11)13(16)17/h3-6,9,12,14H,7-8H2,1-2H3,(H,16,17).
What are the key properties of 4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid?
4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid has a molecular weight of 234.30 g/mol, XLogP of 1.89, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,5-dimethylpyrrolidin-3-yl)amino]benzoic acid is sourced from PubChem (CID 81466326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).