C36H38N2 — CID 160620740
N-cyclopentyl-9H-fluoren-2-amine;3-(1-cyclopropylethyl)-9H-fluoren-2-amine (PubChem CID 160620740) has the molecular formula C36H38N2 and a molecular weight of 498.71 g/mol. Its IUPAC name is N-cyclopentyl-9H-fluoren-2-amine;3-(1-cyclopropylethyl)-9H-fluoren-2-amine.
| Compound Name | N-cyclopentyl-9H-fluoren-2-amine;3-(1-cyclopropylethyl)-9H-fluoren-2-amine |
|---|---|
| PubChem CID | 160620740 |
| Molecular Formula | C36H38N2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | N-cyclopentyl-9H-fluoren-2-amine;3-(1-cyclopropylethyl)-9H-fluoren-2-amine |
| SMILES | CC(c1cc2c(cc1N)Cc1ccccc1-2)C1CC1.c1ccc2c(c1)Cc1cc(NC3CCCC3)ccc1-2 |
| InChI | InChI=1S/2C18H19N/c1-11(12-6-7-12)16-10-17-14(9-18(16)19)8-13-4-2-3-5-15(13)17;1-4-8-17-13(5-1)11-14-12-16(9-10-18(14)17)19-15-6-2-3-7-15/h2-5,9-12H,6-8,19H2,1H3;1,4-5,8-10,12,15,19H,2-3,6-7,11H2 |
| InChIKey | RGQZTIMQZHUVJO-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|