C16H17BrO4 — CID 60885645
2-[2-bromo-4-(hydroxymethyl)-6-methoxyphenoxy]-1-phenylethanol (PubChem CID 60885645) has the molecular formula C16H17BrO4 and a molecular weight of 353.21 g/mol. Its IUPAC name is 2-[2-bromo-4-(hydroxymethyl)-6-methoxyphenoxy]-1-phenylethanol.
| Compound Name | 2-[2-bromo-4-(hydroxymethyl)-6-methoxyphenoxy]-1-phenylethanol |
|---|---|
| PubChem CID | 60885645 |
| Molecular Formula | C16H17BrO4 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-[2-bromo-4-(hydroxymethyl)-6-methoxyphenoxy]-1-phenylethanol |
| SMILES | COc1cc(CO)cc(Br)c1OCC(O)c1ccccc1 |
| InChI | InChI=1S/C16H17BrO4/c1-20-15-8-11(9-18)7-13(17)16(15)21-10-14(19)12-5-3-2-4-6-12/h2-8,14,18-19H,9-10H2,1H3 |
| InChIKey | LKSFEUFNCDGAQR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |