C16H17Cl2NO4 — CID 46307275
2-[2-amino-4-(hydroxymethyl)-6-methoxyphenoxy]-1-(3,4-dichlorophenyl)ethanol (PubChem CID 46307275) has the molecular formula C16H17Cl2NO4 and a molecular weight of 358.22 g/mol. Its IUPAC name is 2-[2-amino-4-(hydroxymethyl)-6-methoxyphenoxy]-1-(3,4-dichlorophenyl)ethanol.
| Compound Name | 2-[2-amino-4-(hydroxymethyl)-6-methoxyphenoxy]-1-(3,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 46307275 |
| Molecular Formula | C16H17Cl2NO4 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 2-[2-amino-4-(hydroxymethyl)-6-methoxyphenoxy]-1-(3,4-dichlorophenyl)ethanol |
| SMILES | COc1cc(CO)cc(N)c1OCC(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2NO4/c1-22-15-5-9(7-20)4-13(19)16(15)23-8-14(21)10-2-3-11(17)12(18)6-10/h2-6,14,20-21H,7-8,19H2,1H3 |
| InChIKey | DFHGBBUUWLKDCI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|