C10H13F3N2O — CID 60890972
2-amino-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]phenol (PubChem CID 60890972) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-amino-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]phenol.
| Compound Name | 2-amino-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 60890972 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-amino-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]phenol |
| SMILES | CN(Cc1ccc(O)c(N)c1)CC(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O/c1-15(6-10(11,12)13)5-7-2-3-9(16)8(14)4-7/h2-4,16H,5-6,14H2,1H3 |
| InChIKey | WHRHWHARHGLWPZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|