C14H19ClFNO3 — CID 60900045
1-(2-chloro-4-fluoroanilino)-3-(oxolan-2-ylmethoxy)propan-2-ol (PubChem CID 60900045) has the molecular formula C14H19ClFNO3 and a molecular weight of 303.76 g/mol. Its IUPAC name is 1-(2-chloro-4-fluoroanilino)-3-(oxolan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-(2-chloro-4-fluoroanilino)-3-(oxolan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 60900045 |
| Molecular Formula | C14H19ClFNO3 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1-(2-chloro-4-fluoroanilino)-3-(oxolan-2-ylmethoxy)propan-2-ol |
| SMILES | OC(CNc1ccc(F)cc1Cl)COCC1CCCO1 |
| InChI | InChI=1S/C14H19ClFNO3/c15-13-6-10(16)3-4-14(13)17-7-11(18)8-19-9-12-2-1-5-20-12/h3-4,6,11-12,17-18H,1-2,5,7-9H2 |
| InChIKey | RHYJOAFNKBPDRS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |