C15H21N3O3 — CID 60906666
1-[3-ethoxy-4-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]butan-2-amine (PubChem CID 60906666) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[3-ethoxy-4-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]butan-2-amine.
| Compound Name | 1-[3-ethoxy-4-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 60906666 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[3-ethoxy-4-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]butan-2-amine |
| SMILES | CCOc1cc(CC(N)CC)ccc1OCc1ncon1 |
| InChI | InChI=1S/C15H21N3O3/c1-3-12(16)7-11-5-6-13(14(8-11)19-4-2)20-9-15-17-10-21-18-15/h5-6,8,10,12H,3-4,7,9,16H2,1-2H3 |
| InChIKey | HILSNXCPOSXRFI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |