C7H13N5O2 — CID 60920992
6-amino-5-hydrazinyl-1-propylpyrimidine-2,4-dione (PubChem CID 60920992) has the molecular formula C7H13N5O2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 6-amino-5-hydrazinyl-1-propylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-hydrazinyl-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60920992 |
| Molecular Formula | C7H13N5O2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 6-amino-5-hydrazinyl-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1c(N)c(NN)c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H13N5O2/c1-2-3-12-5(8)4(11-9)6(13)10-7(12)14/h11H,2-3,8-9H2,1H3,(H,10,13,14) |
| InChIKey | ZOTHKLKCEPQXOO-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|