C12H20N4O2 — CID 115628510
6-amino-5-[[(E)-pent-3-enyl]amino]-1-propylpyrimidine-2,4-dione (PubChem CID 115628510) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 6-amino-5-[[(E)-pent-3-enyl]amino]-1-propylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[[(E)-pent-3-enyl]amino]-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115628510 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 6-amino-5-[[(E)-pent-3-enyl]amino]-1-propylpyrimidine-2,4-dione |
| SMILES | C/C=C/CCNc1c(N)n(CCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H20N4O2/c1-3-5-6-7-14-9-10(13)16(8-4-2)12(18)15-11(9)17/h3,5,14H,4,6-8,13H2,1-2H3,(H,15,17,18)/b5-3+ |
| InChIKey | RWDVXMSWIRFOFG-HWKANZROSA-N |
| XLogP | 0.91 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|