C9H17N5O2 — CID 83026863
6-amino-5-(2,2-dimethylhydrazinyl)-1-propylpyrimidine-2,4-dione (PubChem CID 83026863) has the molecular formula C9H17N5O2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 6-amino-5-(2,2-dimethylhydrazinyl)-1-propylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-(2,2-dimethylhydrazinyl)-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 83026863 |
| Molecular Formula | C9H17N5O2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 6-amino-5-(2,2-dimethylhydrazinyl)-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1c(N)c(NN(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H17N5O2/c1-4-5-14-7(10)6(12-13(2)3)8(15)11-9(14)16/h12H,4-5,10H2,1-3H3,(H,11,15,16) |
| InChIKey | XXNRHWAOMYOUIK-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|