C16H22N2O3 — CID 60934337
3-(2-ethoxy-4-methylanilino)-1-propan-2-ylpyrrolidine-2,5-dione (PubChem CID 60934337) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-(2-ethoxy-4-methylanilino)-1-propan-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-(2-ethoxy-4-methylanilino)-1-propan-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 60934337 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 3-(2-ethoxy-4-methylanilino)-1-propan-2-ylpyrrolidine-2,5-dione |
| SMILES | CCOc1cc(C)ccc1NC1CC(=O)N(C(C)C)C1=O |
| InChI | InChI=1S/C16H22N2O3/c1-5-21-14-8-11(4)6-7-12(14)17-13-9-15(19)18(10(2)3)16(13)20/h6-8,10,13,17H,5,9H2,1-4H3 |
| InChIKey | IYNQQEPHZLJSAO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|