C11H20F3N3O3 — CID 60946902
2-amino-N-[2-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]acetamide (PubChem CID 60946902) has the molecular formula C11H20F3N3O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-amino-N-[2-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 60946902 |
| Molecular Formula | C11H20F3N3O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-amino-N-[2-[3-ethoxypropyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]acetamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)CNC(=O)CN |
| InChI | InChI=1S/C11H20F3N3O3/c1-2-20-5-3-4-17(8-11(12,13)14)10(19)7-16-9(18)6-15/h2-8,15H2,1H3,(H,16,18) |
| InChIKey | MMZUXNBFTJTQAY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|