C14H18O5 — CID 609470
2-(2-hydroxy-6-oxocyclohexen-1-yl)-2-(methoxymethyl)cyclohexane-1,3-dione (PubChem CID 609470) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 2-(2-hydroxy-6-oxocyclohexen-1-yl)-2-(methoxymethyl)cyclohexane-1,3-dione.
| Compound Name | 2-(2-hydroxy-6-oxocyclohexen-1-yl)-2-(methoxymethyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 609470 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(2-hydroxy-6-oxocyclohexen-1-yl)-2-(methoxymethyl)cyclohexane-1,3-dione |
| SMILES | COCC1(C2=C(O)CCCC2=O)C(=O)CCCC1=O |
| InChI | InChI=1S/C14H18O5/c1-19-8-14(11(17)6-3-7-12(14)18)13-9(15)4-2-5-10(13)16/h15H,2-8H2,1H3 |
| InChIKey | MSERZDGRICEXQX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|