C15H22O4 — CID 163078248
5-hydroxy-2,2,6,6-tetramethyl-4-[(2R)-2-methylbutanoyl]cyclohex-4-ene-1,3-dione (PubChem CID 163078248) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 5-hydroxy-2,2,6,6-tetramethyl-4-[(2R)-2-methylbutanoyl]cyclohex-4-ene-1,3-dione.
| Compound Name | 5-hydroxy-2,2,6,6-tetramethyl-4-[(2R)-2-methylbutanoyl]cyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 163078248 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 5-hydroxy-2,2,6,6-tetramethyl-4-[(2R)-2-methylbutanoyl]cyclohex-4-ene-1,3-dione |
| SMILES | CC[C@@H](C)C(=O)C1=C(O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C15H22O4/c1-7-8(2)10(16)9-11(17)14(3,4)13(19)15(5,6)12(9)18/h8,17H,7H2,1-6H3/t8-/m1/s1 |
| InChIKey | MMXVVIZXMZSOJO-MRVPVSSYSA-N |
| XLogP | 2.62 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|